C18H28N4O4 — CID 94057278
1-[(6-methoxy-3-pyridinyl)methyl]-3-[(2S)-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethyl]urea (PubChem CID 94057278) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-[(6-methoxy-3-pyridinyl)methyl]-3-[(2S)-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethyl]urea.
| Compound Name | 1-[(6-methoxy-3-pyridinyl)methyl]-3-[(2S)-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethyl]urea |
|---|---|
| PubChem CID | 94057278 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 1-[(6-methoxy-3-pyridinyl)methyl]-3-[(2S)-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethyl]urea |
| SMILES | COc1ccc(CNC(=O)NC[C@H]([C@@H]2CCOC2)N2CCOCC2)cn1 |
| InChI | InChI=1S/C18H28N4O4/c1-24-17-3-2-14(10-19-17)11-20-18(23)21-12-16(15-4-7-26-13-15)22-5-8-25-9-6-22/h2-3,10,15-16H,4-9,11-13H2,1H3,(H2,20,21,23)/t15-,16-/m1/s1 |
| InChIKey | KBLOJAXXRDFLDY-HZPDHXFCSA-N |
| XLogP | 0.63 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |