C16H24N4O3 — CID 94030463
1-[(2S)-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethyl]-3-pyridin-4-ylurea (PubChem CID 94030463) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-[(2S)-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethyl]-3-pyridin-4-ylurea.
| Compound Name | 1-[(2S)-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethyl]-3-pyridin-4-ylurea |
|---|---|
| PubChem CID | 94030463 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 1-[(2S)-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethyl]-3-pyridin-4-ylurea |
| SMILES | O=C(NC[C@H]([C@@H]1CCOC1)N1CCOCC1)Nc1ccncc1 |
| InChI | InChI=1S/C16H24N4O3/c21-16(19-14-1-4-17-5-2-14)18-11-15(13-3-8-23-12-13)20-6-9-22-10-7-20/h1-2,4-5,13,15H,3,6-12H2,(H2,17,18,19,21)/t13-,15-/m1/s1 |
| InChIKey | FXJYSNDRWBJSAY-UKRRQHHQSA-N |
| XLogP | 0.94 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |