C18H28N4O3 — CID 94031834
1-(2-ethoxy-3-pyridinyl)-3-[(2R)-2-[(3R)-oxolan-3-yl]-2-pyrrolidin-1-ylethyl]urea (PubChem CID 94031834) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-(2-ethoxy-3-pyridinyl)-3-[(2R)-2-[(3R)-oxolan-3-yl]-2-pyrrolidin-1-ylethyl]urea.
| Compound Name | 1-(2-ethoxy-3-pyridinyl)-3-[(2R)-2-[(3R)-oxolan-3-yl]-2-pyrrolidin-1-ylethyl]urea |
|---|---|
| PubChem CID | 94031834 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 1-(2-ethoxy-3-pyridinyl)-3-[(2R)-2-[(3R)-oxolan-3-yl]-2-pyrrolidin-1-ylethyl]urea |
| SMILES | CCOc1ncccc1NC(=O)NC[C@@H]([C@H]1CCOC1)N1CCCC1 |
| InChI | InChI=1S/C18H28N4O3/c1-2-25-17-15(6-5-8-19-17)21-18(23)20-12-16(14-7-11-24-13-14)22-9-3-4-10-22/h5-6,8,14,16H,2-4,7,9-13H2,1H3,(H2,20,21,23)/t14-,16-/m0/s1 |
| InChIKey | OQUOEVHRORDZML-HOCLYGCPSA-N |
| XLogP | 2.10 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |