C23H28ClN3O3 — CID 47049754
1-[4-(2-chlorophenoxy)phenyl]-3-[2-(oxolan-3-yl)-2-pyrrolidin-1-ylethyl]urea (PubChem CID 47049754) has the molecular formula C23H28ClN3O3 and a molecular weight of 429.95 g/mol. Its IUPAC name is 1-[4-(2-chlorophenoxy)phenyl]-3-[2-(oxolan-3-yl)-2-pyrrolidin-1-ylethyl]urea.
| Compound Name | 1-[4-(2-chlorophenoxy)phenyl]-3-[2-(oxolan-3-yl)-2-pyrrolidin-1-ylethyl]urea |
|---|---|
| PubChem CID | 47049754 |
| Molecular Formula | C23H28ClN3O3 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 1-[4-(2-chlorophenoxy)phenyl]-3-[2-(oxolan-3-yl)-2-pyrrolidin-1-ylethyl]urea |
| SMILES | O=C(NCC(C1CCOC1)N1CCCC1)Nc1ccc(Oc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H28ClN3O3/c24-20-5-1-2-6-22(20)30-19-9-7-18(8-10-19)26-23(28)25-15-21(17-11-14-29-16-17)27-12-3-4-13-27/h1-2,5-10,17,21H,3-4,11-16H2,(H2,25,26,28) |
| InChIKey | RMOMMLZWLWHHAY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |