C17H24N4O5 — CID 42942600
1-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-3-(4-nitrophenyl)urea (PubChem CID 42942600) has the molecular formula C17H24N4O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is 1-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 42942600 |
| Molecular Formula | C17H24N4O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 1-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-3-(4-nitrophenyl)urea |
| SMILES | O=C(NCC(C1CCOC1)N1CCOCC1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H24N4O5/c22-17(19-14-1-3-15(4-2-14)21(23)24)18-11-16(13-5-8-26-12-13)20-6-9-25-10-7-20/h1-4,13,16H,5-12H2,(H2,18,19,22) |
| InChIKey | LDSVLBRTXAFUNZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|