C19H29N5O5 — CID 55590017
1-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-3-[2-(2-nitroanilino)ethyl]urea (PubChem CID 55590017) has the molecular formula C19H29N5O5 and a molecular weight of 407.47 g/mol. Its IUPAC name is 1-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-3-[2-(2-nitroanilino)ethyl]urea.
| Compound Name | 1-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-3-[2-(2-nitroanilino)ethyl]urea |
|---|---|
| PubChem CID | 55590017 |
| Molecular Formula | C19H29N5O5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 1-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-3-[2-(2-nitroanilino)ethyl]urea |
| SMILES | O=C(NCCNc1ccccc1[N+](=O)[O-])NCC(C1CCOC1)N1CCOCC1 |
| InChI | InChI=1S/C19H29N5O5/c25-19(21-7-6-20-16-3-1-2-4-17(16)24(26)27)22-13-18(15-5-10-29-14-15)23-8-11-28-12-9-23/h1-4,15,18,20H,5-14H2,(H2,21,22,25) |
| InChIKey | JYVQHCCOHUAKRD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|