C16H24N4O4 — CID 94824919
3-methyl-N-[(2R)-2-morpholin-4-yl-2-[(3R)-oxolan-3-yl]ethyl]-5-nitropyridin-2-amine (PubChem CID 94824919) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 3-methyl-N-[(2R)-2-morpholin-4-yl-2-[(3R)-oxolan-3-yl]ethyl]-5-nitropyridin-2-amine.
| Compound Name | 3-methyl-N-[(2R)-2-morpholin-4-yl-2-[(3R)-oxolan-3-yl]ethyl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 94824919 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 3-methyl-N-[(2R)-2-morpholin-4-yl-2-[(3R)-oxolan-3-yl]ethyl]-5-nitropyridin-2-amine |
| SMILES | Cc1cc([N+](=O)[O-])cnc1NC[C@@H]([C@H]1CCOC1)N1CCOCC1 |
| InChI | InChI=1S/C16H24N4O4/c1-12-8-14(20(21)22)9-17-16(12)18-10-15(13-2-5-24-11-13)19-3-6-23-7-4-19/h8-9,13,15H,2-7,10-11H2,1H3,(H,17,18)/t13-,15-/m0/s1 |
| InChIKey | CYIFFNTZSLRGTN-ZFWWWQNUSA-N |
| XLogP | 1.45 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|