C20H29N5O4 — CID 51116384
1-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea (PubChem CID 51116384) has the molecular formula C20H29N5O4 and a molecular weight of 403.48 g/mol. Its IUPAC name is 1-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea.
| Compound Name | 1-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 51116384 |
| Molecular Formula | C20H29N5O4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 1-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea |
| SMILES | O=C(NCC(C1CCOC1)N1CCOCC1)Nc1cccc(N2CCNC2=O)c1 |
| InChI | InChI=1S/C20H29N5O4/c26-19(23-16-2-1-3-17(12-16)25-6-5-21-20(25)27)22-13-18(15-4-9-29-14-15)24-7-10-28-11-8-24/h1-3,12,15,18H,4-11,13-14H2,(H,21,27)(H2,22,23,26) |
| InChIKey | JCOKHMJPOOPILD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |