C17H24N4O3 — CID 120795442
2-amino-2-(oxan-4-yl)-N-[3-(2-oxo-1,3-diazinan-1-yl)phenyl]acetamide (PubChem CID 120795442) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-amino-2-(oxan-4-yl)-N-[3-(2-oxo-1,3-diazinan-1-yl)phenyl]acetamide.
| Compound Name | 2-amino-2-(oxan-4-yl)-N-[3-(2-oxo-1,3-diazinan-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 120795442 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 2-amino-2-(oxan-4-yl)-N-[3-(2-oxo-1,3-diazinan-1-yl)phenyl]acetamide |
| SMILES | NC(C(=O)Nc1cccc(N2CCCNC2=O)c1)C1CCOCC1 |
| InChI | InChI=1S/C17H24N4O3/c18-15(12-5-9-24-10-6-12)16(22)20-13-3-1-4-14(11-13)21-8-2-7-19-17(21)23/h1,3-4,11-12,15H,2,5-10,18H2,(H,19,23)(H,20,22) |
| InChIKey | HLUKEPWTYRGUMW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |