C15H23ClN4O2 — CID 119338335
2-amino-N-[3-(2-oxo-1,3-diazinan-1-yl)phenyl]pentanamide;hydrochloride (PubChem CID 119338335) has the molecular formula C15H23ClN4O2 and a molecular weight of 326.83 g/mol. Its IUPAC name is 2-amino-N-[3-(2-oxo-1,3-diazinan-1-yl)phenyl]pentanamide;hydrochloride.
| Compound Name | 2-amino-N-[3-(2-oxo-1,3-diazinan-1-yl)phenyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119338335 |
| Molecular Formula | C15H23ClN4O2 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-amino-N-[3-(2-oxo-1,3-diazinan-1-yl)phenyl]pentanamide;hydrochloride |
| SMILES | CCCC(N)C(=O)Nc1cccc(N2CCCNC2=O)c1.Cl |
| InChI | InChI=1S/C15H22N4O2.ClH/c1-2-5-13(16)14(20)18-11-6-3-7-12(10-11)19-9-4-8-17-15(19)21;/h3,6-7,10,13H,2,4-5,8-9,16H2,1H3,(H,17,21)(H,18,20);1H |
| InChIKey | UHIVLILXKSGUDM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |