C19H21N3O3 — CID 122160047
2-methoxy-N-[3-(2-oxo-1,3-diazinan-1-yl)phenyl]-2-phenylacetamide (PubChem CID 122160047) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-methoxy-N-[3-(2-oxo-1,3-diazinan-1-yl)phenyl]-2-phenylacetamide.
| Compound Name | 2-methoxy-N-[3-(2-oxo-1,3-diazinan-1-yl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 122160047 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-methoxy-N-[3-(2-oxo-1,3-diazinan-1-yl)phenyl]-2-phenylacetamide |
| SMILES | COC(C(=O)Nc1cccc(N2CCCNC2=O)c1)c1ccccc1 |
| InChI | InChI=1S/C19H21N3O3/c1-25-17(14-7-3-2-4-8-14)18(23)21-15-9-5-10-16(13-15)22-12-6-11-20-19(22)24/h2-5,7-10,13,17H,6,11-12H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | PPTBBWUQAHADRH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |