C14H18N6O2 — CID 120784046
2-amino-2-(oxan-4-yl)-N-[3-(tetrazol-1-yl)phenyl]acetamide (PubChem CID 120784046) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 2-amino-2-(oxan-4-yl)-N-[3-(tetrazol-1-yl)phenyl]acetamide.
| Compound Name | 2-amino-2-(oxan-4-yl)-N-[3-(tetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 120784046 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-amino-2-(oxan-4-yl)-N-[3-(tetrazol-1-yl)phenyl]acetamide |
| SMILES | NC(C(=O)Nc1cccc(-n2cnnn2)c1)C1CCOCC1 |
| InChI | InChI=1S/C14H18N6O2/c15-13(10-4-6-22-7-5-10)14(21)17-11-2-1-3-12(8-11)20-9-16-18-19-20/h1-3,8-10,13H,4-7,15H2,(H,17,21) |
| InChIKey | RILUHVZRIFGLQT-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |