C16H23N5O3 — CID 47039442
2-methyl-N-[2-[[3-(2-oxoimidazolidin-1-yl)phenyl]carbamoylamino]ethyl]propanamide (PubChem CID 47039442) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-methyl-N-[2-[[3-(2-oxoimidazolidin-1-yl)phenyl]carbamoylamino]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[[3-(2-oxoimidazolidin-1-yl)phenyl]carbamoylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 47039442 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 2-methyl-N-[2-[[3-(2-oxoimidazolidin-1-yl)phenyl]carbamoylamino]ethyl]propanamide |
| SMILES | CC(C)C(=O)NCCNC(=O)Nc1cccc(N2CCNC2=O)c1 |
| InChI | InChI=1S/C16H23N5O3/c1-11(2)14(22)17-6-7-18-15(23)20-12-4-3-5-13(10-12)21-9-8-19-16(21)24/h3-5,10-11H,6-9H2,1-2H3,(H,17,22)(H,19,24)(H2,18,20,23) |
| InChIKey | IKJFAWKTPVGVLS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|