C19H28N4O3 — CID 51116378
1-[2-(2-methylcyclohexyl)oxyethyl]-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea (PubChem CID 51116378) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-[2-(2-methylcyclohexyl)oxyethyl]-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea.
| Compound Name | 1-[2-(2-methylcyclohexyl)oxyethyl]-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 51116378 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-[2-(2-methylcyclohexyl)oxyethyl]-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea |
| SMILES | CC1CCCCC1OCCNC(=O)Nc1cccc(N2CCNC2=O)c1 |
| InChI | InChI=1S/C19H28N4O3/c1-14-5-2-3-8-17(14)26-12-10-20-18(24)22-15-6-4-7-16(13-15)23-11-9-21-19(23)25/h4,6-7,13-14,17H,2-3,5,8-12H2,1H3,(H,21,25)(H2,20,22,24) |
| InChIKey | TXNIUHZRCZUDJS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|