C24H31N3O3 — CID 52519000
N-methyl-3-[2-[(1S,2S)-2-methylcyclohexyl]oxyethylcarbamoylamino]-N-phenylbenzamide (PubChem CID 52519000) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is N-methyl-3-[2-[(1S,2S)-2-methylcyclohexyl]oxyethylcarbamoylamino]-N-phenylbenzamide.
| Compound Name | N-methyl-3-[2-[(1S,2S)-2-methylcyclohexyl]oxyethylcarbamoylamino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 52519000 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | N-methyl-3-[2-[(1S,2S)-2-methylcyclohexyl]oxyethylcarbamoylamino]-N-phenylbenzamide |
| SMILES | C[C@H]1CCCC[C@@H]1OCCNC(=O)Nc1cccc(C(=O)N(C)c2ccccc2)c1 |
| InChI | InChI=1S/C24H31N3O3/c1-18-9-6-7-14-22(18)30-16-15-25-24(29)26-20-11-8-10-19(17-20)23(28)27(2)21-12-4-3-5-13-21/h3-5,8,10-13,17-18,22H,6-7,9,14-16H2,1-2H3,(H2,25,26,29)/t18-,22-/m0/s1 |
| InChIKey | SCRVFBVYMVFLIT-AVRDEDQJSA-N |
| XLogP | 4.68 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|