C18H26N6O2 — CID 51946446
1-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]-3-[3-(5-methyltetrazol-1-yl)phenyl]urea (PubChem CID 51946446) has the molecular formula C18H26N6O2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 1-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]-3-[3-(5-methyltetrazol-1-yl)phenyl]urea.
| Compound Name | 1-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]-3-[3-(5-methyltetrazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 51946446 |
| Molecular Formula | C18H26N6O2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 1-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]-3-[3-(5-methyltetrazol-1-yl)phenyl]urea |
| SMILES | Cc1nnnn1-c1cccc(NC(=O)NCCO[C@H]2CCCC[C@@H]2C)c1 |
| InChI | InChI=1S/C18H26N6O2/c1-13-6-3-4-9-17(13)26-11-10-19-18(25)20-15-7-5-8-16(12-15)24-14(2)21-22-23-24/h5,7-8,12-13,17H,3-4,6,9-11H2,1-2H3,(H2,19,20,25)/t13-,17-/m0/s1 |
| InChIKey | MXHZUORXZLSEHG-GUYCJALGSA-N |
| XLogP | 2.69 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|