C14H18N8O2 — CID 72875346
1-[3-(5-methyltetrazol-1-yl)phenyl]-3-[2-(2-oxoimidazolidin-1-yl)ethyl]urea (PubChem CID 72875346) has the molecular formula C14H18N8O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 1-[3-(5-methyltetrazol-1-yl)phenyl]-3-[2-(2-oxoimidazolidin-1-yl)ethyl]urea.
| Compound Name | 1-[3-(5-methyltetrazol-1-yl)phenyl]-3-[2-(2-oxoimidazolidin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 72875346 |
| Molecular Formula | C14H18N8O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-[3-(5-methyltetrazol-1-yl)phenyl]-3-[2-(2-oxoimidazolidin-1-yl)ethyl]urea |
| SMILES | Cc1nnnn1-c1cccc(NC(=O)NCCN2CCNC2=O)c1 |
| InChI | InChI=1S/C14H18N8O2/c1-10-18-19-20-22(10)12-4-2-3-11(9-12)17-13(23)15-5-7-21-8-6-16-14(21)24/h2-4,9H,5-8H2,1H3,(H,16,24)(H2,15,17,23) |
| InChIKey | OYIGCLYASWOWGQ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 117.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |