C13H19N5O4S — CID 72931818
1-[2-(2-oxoimidazolidin-1-yl)ethyl]-3-[3-(sulfamoylmethyl)phenyl]urea (PubChem CID 72931818) has the molecular formula C13H19N5O4S and a molecular weight of 341.39 g/mol. Its IUPAC name is 1-[2-(2-oxoimidazolidin-1-yl)ethyl]-3-[3-(sulfamoylmethyl)phenyl]urea.
| Compound Name | 1-[2-(2-oxoimidazolidin-1-yl)ethyl]-3-[3-(sulfamoylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 72931818 |
| Molecular Formula | C13H19N5O4S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 1-[2-(2-oxoimidazolidin-1-yl)ethyl]-3-[3-(sulfamoylmethyl)phenyl]urea |
| SMILES | NS(=O)(=O)Cc1cccc(NC(=O)NCCN2CCNC2=O)c1 |
| InChI | InChI=1S/C13H19N5O4S/c14-23(21,22)9-10-2-1-3-11(8-10)17-12(19)15-4-6-18-7-5-16-13(18)20/h1-3,8H,4-7,9H2,(H,16,20)(H2,14,21,22)(H2,15,17,19) |
| InChIKey | UCIDSYDERLTVRG-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |