C14H21N5O5S — CID 118763815
1-[3-(methanesulfonamido)-4-methoxyphenyl]-3-[2-(2-oxoimidazolidin-1-yl)ethyl]urea (PubChem CID 118763815) has the molecular formula C14H21N5O5S and a molecular weight of 371.42 g/mol. Its IUPAC name is 1-[3-(methanesulfonamido)-4-methoxyphenyl]-3-[2-(2-oxoimidazolidin-1-yl)ethyl]urea.
| Compound Name | 1-[3-(methanesulfonamido)-4-methoxyphenyl]-3-[2-(2-oxoimidazolidin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 118763815 |
| Molecular Formula | C14H21N5O5S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 1-[3-(methanesulfonamido)-4-methoxyphenyl]-3-[2-(2-oxoimidazolidin-1-yl)ethyl]urea |
| SMILES | COc1ccc(NC(=O)NCCN2CCNC2=O)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C14H21N5O5S/c1-24-12-4-3-10(9-11(12)18-25(2,22)23)17-13(20)15-5-7-19-8-6-16-14(19)21/h3-4,9,18H,5-8H2,1-2H3,(H,16,21)(H2,15,17,20) |
| InChIKey | BKWCOXADHSWQST-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |