C22H29N7O — CID 143448051
1-[4-[methyl-[(4-methylphenyl)methyl]amino]butyl]-3-[3-(5-methyltetrazol-1-yl)phenyl]urea (PubChem CID 143448051) has the molecular formula C22H29N7O and a molecular weight of 407.52 g/mol. Its IUPAC name is 1-[4-[methyl-[(4-methylphenyl)methyl]amino]butyl]-3-[3-(5-methyltetrazol-1-yl)phenyl]urea.
| Compound Name | 1-[4-[methyl-[(4-methylphenyl)methyl]amino]butyl]-3-[3-(5-methyltetrazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 143448051 |
| Molecular Formula | C22H29N7O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 1-[4-[methyl-[(4-methylphenyl)methyl]amino]butyl]-3-[3-(5-methyltetrazol-1-yl)phenyl]urea |
| SMILES | Cc1ccc(CN(C)CCCCNC(=O)Nc2cccc(-n3nnnc3C)c2)cc1 |
| InChI | InChI=1S/C22H29N7O/c1-17-9-11-19(12-10-17)16-28(3)14-5-4-13-23-22(30)24-20-7-6-8-21(15-20)29-18(2)25-26-27-29/h6-12,15H,4-5,13-14,16H2,1-3H3,(H2,23,24,30) |
| InChIKey | DKNQZWGYMXEENK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|