C21H25BrFN7O — CID 59862596
1-[3-bromo-5-(1-methyltetrazol-5-yl)phenyl]-3-[4-[(4-fluorophenyl)methyl-methylamino]butyl]urea (PubChem CID 59862596) has the molecular formula C21H25BrFN7O and a molecular weight of 490.38 g/mol. Its IUPAC name is 1-[3-bromo-5-(1-methyltetrazol-5-yl)phenyl]-3-[4-[(4-fluorophenyl)methyl-methylamino]butyl]urea.
| Compound Name | 1-[3-bromo-5-(1-methyltetrazol-5-yl)phenyl]-3-[4-[(4-fluorophenyl)methyl-methylamino]butyl]urea |
|---|---|
| PubChem CID | 59862596 |
| Molecular Formula | C21H25BrFN7O |
| Molecular Weight | 490.38 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 1-[3-bromo-5-(1-methyltetrazol-5-yl)phenyl]-3-[4-[(4-fluorophenyl)methyl-methylamino]butyl]urea |
| SMILES | CN(CCCCNC(=O)Nc1cc(Br)cc(-c2nnnn2C)c1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H25BrFN7O/c1-29(14-15-5-7-18(23)8-6-15)10-4-3-9-24-21(31)25-19-12-16(11-17(22)13-19)20-26-27-28-30(20)2/h5-8,11-13H,3-4,9-10,14H2,1-2H3,(H2,24,25,31) |
| InChIKey | IBIDCKALWLKHAN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|