C26H32FN11O — CID 22393477
1-[3,5-bis(1-methyltetrazol-5-yl)phenyl]-3-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]urea (PubChem CID 22393477) has the molecular formula C26H32FN11O and a molecular weight of 533.62 g/mol. Its IUPAC name is 1-[3,5-bis(1-methyltetrazol-5-yl)phenyl]-3-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]urea.
| Compound Name | 1-[3,5-bis(1-methyltetrazol-5-yl)phenyl]-3-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 22393477 |
| Molecular Formula | C26H32FN11O |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 1-[3,5-bis(1-methyltetrazol-5-yl)phenyl]-3-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]urea |
| SMILES | Cn1nnnc1-c1cc(NC(=O)NCCCN2CCCC(Cc3ccc(F)cc3)C2)cc(-c2nnnn2C)c1 |
| InChI | InChI=1S/C26H32FN11O/c1-36-24(30-32-34-36)20-14-21(25-31-33-35-37(25)2)16-23(15-20)29-26(39)28-10-4-12-38-11-3-5-19(17-38)13-18-6-8-22(27)9-7-18/h6-9,14-16,19H,3-5,10-13,17H2,1-2H3,(H2,28,29,39) |
| InChIKey | CWHSVBGJMSCSMQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|