C29H39FN8O — CID 22393367
1-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]-3-[3-(1-methyltetrazol-5-yl)-4-piperidin-1-ylphenyl]urea (PubChem CID 22393367) has the molecular formula C29H39FN8O and a molecular weight of 534.68 g/mol. Its IUPAC name is 1-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]-3-[3-(1-methyltetrazol-5-yl)-4-piperidin-1-ylphenyl]urea.
| Compound Name | 1-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]-3-[3-(1-methyltetrazol-5-yl)-4-piperidin-1-ylphenyl]urea |
|---|---|
| PubChem CID | 22393367 |
| Molecular Formula | C29H39FN8O |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | 1-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]-3-[3-(1-methyltetrazol-5-yl)-4-piperidin-1-ylphenyl]urea |
| SMILES | Cn1nnnc1-c1cc(NC(=O)NCCCN2CCCC(Cc3ccc(F)cc3)C2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C29H39FN8O/c1-36-28(33-34-35-36)26-20-25(12-13-27(26)38-17-3-2-4-18-38)32-29(39)31-14-6-16-37-15-5-7-23(21-37)19-22-8-10-24(30)11-9-22/h8-13,20,23H,2-7,14-19,21H2,1H3,(H2,31,32,39) |
| InChIKey | PLAKFETZJLRAKR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|