C24H29FN4O — CID 22393300
1-(3-cyanophenyl)-3-[4-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]butyl]urea (PubChem CID 22393300) has the molecular formula C24H29FN4O and a molecular weight of 408.52 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[4-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]butyl]urea.
| Compound Name | 1-(3-cyanophenyl)-3-[4-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]butyl]urea |
|---|---|
| PubChem CID | 22393300 |
| Molecular Formula | C24H29FN4O |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[4-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]butyl]urea |
| SMILES | N#Cc1cccc(NC(=O)NCCCCN2CCCC(Cc3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C24H29FN4O/c25-22-10-8-19(9-11-22)15-21-6-4-14-29(18-21)13-2-1-12-27-24(30)28-23-7-3-5-20(16-23)17-26/h3,5,7-11,16,21H,1-2,4,6,12-15,18H2,(H2,27,28,30) |
| InChIKey | HUVJJNJVNYQCNL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|