C23H27FN4O — CID 22393396
1-(3-cyanophenyl)-3-[3-[3-[(3-fluorophenyl)methyl]piperidin-1-yl]propyl]urea (PubChem CID 22393396) has the molecular formula C23H27FN4O and a molecular weight of 394.49 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[3-[3-[(3-fluorophenyl)methyl]piperidin-1-yl]propyl]urea.
| Compound Name | 1-(3-cyanophenyl)-3-[3-[3-[(3-fluorophenyl)methyl]piperidin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 22393396 |
| Molecular Formula | C23H27FN4O |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[3-[3-[(3-fluorophenyl)methyl]piperidin-1-yl]propyl]urea |
| SMILES | N#Cc1cccc(NC(=O)NCCCN2CCCC(Cc3cccc(F)c3)C2)c1 |
| InChI | InChI=1S/C23H27FN4O/c24-21-8-1-5-18(14-21)13-20-7-3-11-28(17-20)12-4-10-26-23(29)27-22-9-2-6-19(15-22)16-25/h1-2,5-6,8-9,14-15,20H,3-4,7,10-13,17H2,(H2,26,27,29) |
| InChIKey | HLHXMMQPQUWWII-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|