C24H31FN4O — CID 22393444
1-(2,3-dihydro-1H-indol-5-yl)-3-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]urea (PubChem CID 22393444) has the molecular formula C24H31FN4O and a molecular weight of 410.54 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-indol-5-yl)-3-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]urea.
| Compound Name | 1-(2,3-dihydro-1H-indol-5-yl)-3-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 22393444 |
| Molecular Formula | C24H31FN4O |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 1-(2,3-dihydro-1H-indol-5-yl)-3-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]urea |
| SMILES | O=C(NCCCN1CCCC(Cc2ccc(F)cc2)C1)Nc1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C24H31FN4O/c25-21-6-4-18(5-7-21)15-19-3-1-13-29(17-19)14-2-11-27-24(30)28-22-8-9-23-20(16-22)10-12-26-23/h4-9,16,19,26H,1-3,10-15,17H2,(H2,27,28,30) |
| InChIKey | XVSDSIHPHQOYOY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|