C20H22F3N3O2 — CID 11696845
1-(3,4-difluorophenyl)-3-[3-[3-(4-fluorophenoxy)pyrrolidin-1-yl]propyl]urea (PubChem CID 11696845) has the molecular formula C20H22F3N3O2 and a molecular weight of 393.41 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[3-[3-(4-fluorophenoxy)pyrrolidin-1-yl]propyl]urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-[3-[3-(4-fluorophenoxy)pyrrolidin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 11696845 |
| Molecular Formula | C20H22F3N3O2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[3-[3-(4-fluorophenoxy)pyrrolidin-1-yl]propyl]urea |
| SMILES | O=C(NCCCN1CCC(Oc2ccc(F)cc2)C1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H22F3N3O2/c21-14-2-5-16(6-3-14)28-17-8-11-26(13-17)10-1-9-24-20(27)25-15-4-7-18(22)19(23)12-15/h2-7,12,17H,1,8-11,13H2,(H2,24,25,27) |
| InChIKey | YWGSVUFAWQJSPD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|