C21H26FN3O3 — CID 72924084
1-[2-(4-fluorophenoxy)ethyl]-3-[4-(1-methylpiperidin-4-yl)oxyphenyl]urea (PubChem CID 72924084) has the molecular formula C21H26FN3O3 and a molecular weight of 387.46 g/mol. Its IUPAC name is 1-[2-(4-fluorophenoxy)ethyl]-3-[4-(1-methylpiperidin-4-yl)oxyphenyl]urea.
| Compound Name | 1-[2-(4-fluorophenoxy)ethyl]-3-[4-(1-methylpiperidin-4-yl)oxyphenyl]urea |
|---|---|
| PubChem CID | 72924084 |
| Molecular Formula | C21H26FN3O3 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 1-[2-(4-fluorophenoxy)ethyl]-3-[4-(1-methylpiperidin-4-yl)oxyphenyl]urea |
| SMILES | CN1CCC(Oc2ccc(NC(=O)NCCOc3ccc(F)cc3)cc2)CC1 |
| InChI | InChI=1S/C21H26FN3O3/c1-25-13-10-20(11-14-25)28-19-8-4-17(5-9-19)24-21(26)23-12-15-27-18-6-2-16(22)3-7-18/h2-9,20H,10-15H2,1H3,(H2,23,24,26) |
| InChIKey | PCQIHADVLCASAL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|