C18H21FN2O2 — CID 112974631
1-(4-fluorophenyl)-3-[2-(2,4,6-trimethylphenoxy)ethyl]urea (PubChem CID 112974631) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[2-(2,4,6-trimethylphenoxy)ethyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[2-(2,4,6-trimethylphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 112974631 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[2-(2,4,6-trimethylphenoxy)ethyl]urea |
| SMILES | Cc1cc(C)c(OCCNC(=O)Nc2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C18H21FN2O2/c1-12-10-13(2)17(14(3)11-12)23-9-8-20-18(22)21-16-6-4-15(19)5-7-16/h4-7,10-11H,8-9H2,1-3H3,(H2,20,21,22) |
| InChIKey | VMQYTAQXHFNYQD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|