C17H19FN2O4 — CID 112975532
1-[2-(2,3-dimethoxyphenoxy)ethyl]-3-(4-fluorophenyl)urea (PubChem CID 112975532) has the molecular formula C17H19FN2O4 and a molecular weight of 334.35 g/mol. Its IUPAC name is 1-[2-(2,3-dimethoxyphenoxy)ethyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[2-(2,3-dimethoxyphenoxy)ethyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 112975532 |
| Molecular Formula | C17H19FN2O4 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 1-[2-(2,3-dimethoxyphenoxy)ethyl]-3-(4-fluorophenyl)urea |
| SMILES | COc1cccc(OCCNC(=O)Nc2ccc(F)cc2)c1OC |
| InChI | InChI=1S/C17H19FN2O4/c1-22-14-4-3-5-15(16(14)23-2)24-11-10-19-17(21)20-13-8-6-12(18)7-9-13/h3-9H,10-11H2,1-2H3,(H2,19,20,21) |
| InChIKey | HCSGNYHHVBTFAH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|