C21H28N2O4 — CID 112975528
1-[2-(2,3-dimethoxyphenoxy)ethyl]-3-(2-methyl-6-propan-2-ylphenyl)urea (PubChem CID 112975528) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[2-(2,3-dimethoxyphenoxy)ethyl]-3-(2-methyl-6-propan-2-ylphenyl)urea.
| Compound Name | 1-[2-(2,3-dimethoxyphenoxy)ethyl]-3-(2-methyl-6-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 112975528 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1-[2-(2,3-dimethoxyphenoxy)ethyl]-3-(2-methyl-6-propan-2-ylphenyl)urea |
| SMILES | COc1cccc(OCCNC(=O)Nc2c(C)cccc2C(C)C)c1OC |
| InChI | InChI=1S/C21H28N2O4/c1-14(2)16-9-6-8-15(3)19(16)23-21(24)22-12-13-27-18-11-7-10-17(25-4)20(18)26-5/h6-11,14H,12-13H2,1-5H3,(H2,22,23,24) |
| InChIKey | CPBORWNAQHMKLK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|