C17H17F3N2O4 — CID 112975591
1-[2-(2,3-dimethoxyphenoxy)ethyl]-3-(2,3,4-trifluorophenyl)urea (PubChem CID 112975591) has the molecular formula C17H17F3N2O4 and a molecular weight of 370.33 g/mol. Its IUPAC name is 1-[2-(2,3-dimethoxyphenoxy)ethyl]-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-[2-(2,3-dimethoxyphenoxy)ethyl]-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 112975591 |
| Molecular Formula | C17H17F3N2O4 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1-[2-(2,3-dimethoxyphenoxy)ethyl]-3-(2,3,4-trifluorophenyl)urea |
| SMILES | COc1cccc(OCCNC(=O)Nc2ccc(F)c(F)c2F)c1OC |
| InChI | InChI=1S/C17H17F3N2O4/c1-24-12-4-3-5-13(16(12)25-2)26-9-8-21-17(23)22-11-7-6-10(18)14(19)15(11)20/h3-7H,8-9H2,1-2H3,(H2,21,22,23) |
| InChIKey | INDSJEBILJEULW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|