C17H17F3N2O2 — CID 112971807
1-[2-(2-ethylphenoxy)ethyl]-3-(2,3,4-trifluorophenyl)urea (PubChem CID 112971807) has the molecular formula C17H17F3N2O2 and a molecular weight of 338.33 g/mol. Its IUPAC name is 1-[2-(2-ethylphenoxy)ethyl]-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-[2-(2-ethylphenoxy)ethyl]-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 112971807 |
| Molecular Formula | C17H17F3N2O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-[2-(2-ethylphenoxy)ethyl]-3-(2,3,4-trifluorophenyl)urea |
| SMILES | CCc1ccccc1OCCNC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H17F3N2O2/c1-2-11-5-3-4-6-14(11)24-10-9-21-17(23)22-13-8-7-12(18)15(19)16(13)20/h3-8H,2,9-10H2,1H3,(H2,21,22,23) |
| InChIKey | WHGHWVJCDBJXII-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|