C11H13F3N2O3 — CID 108892530
1-[2-(2-hydroxyethoxy)ethyl]-3-(2,3,4-trifluorophenyl)urea (PubChem CID 108892530) has the molecular formula C11H13F3N2O3 and a molecular weight of 278.23 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethoxy)ethyl]-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-[2-(2-hydroxyethoxy)ethyl]-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 108892530 |
| Molecular Formula | C11H13F3N2O3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-[2-(2-hydroxyethoxy)ethyl]-3-(2,3,4-trifluorophenyl)urea |
| SMILES | O=C(NCCOCCO)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H13F3N2O3/c12-7-1-2-8(10(14)9(7)13)16-11(18)15-3-5-19-6-4-17/h1-2,17H,3-6H2,(H2,15,16,18) |
| InChIKey | RFJIRCXSNZYIAO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|