C12H17ClN2O4 — CID 108875526
1-(5-chloro-2-methoxyphenyl)-3-[2-(2-hydroxyethoxy)ethyl]urea (PubChem CID 108875526) has the molecular formula C12H17ClN2O4 and a molecular weight of 288.73 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[2-(2-hydroxyethoxy)ethyl]urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[2-(2-hydroxyethoxy)ethyl]urea |
|---|---|
| PubChem CID | 108875526 |
| Molecular Formula | C12H17ClN2O4 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[2-(2-hydroxyethoxy)ethyl]urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)NCCOCCO |
| InChI | InChI=1S/C12H17ClN2O4/c1-18-11-3-2-9(13)8-10(11)15-12(17)14-4-6-19-7-5-16/h2-3,8,16H,4-7H2,1H3,(H2,14,15,17) |
| InChIKey | CNVLLVYIOSDYCQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|