C16H15F3N2O3 — CID 108877405
1-[(2-ethoxyphenoxy)methyl]-3-(2,3,4-trifluorophenyl)urea (PubChem CID 108877405) has the molecular formula C16H15F3N2O3 and a molecular weight of 340.30 g/mol. Its IUPAC name is 1-[(2-ethoxyphenoxy)methyl]-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-[(2-ethoxyphenoxy)methyl]-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 108877405 |
| Molecular Formula | C16H15F3N2O3 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1-[(2-ethoxyphenoxy)methyl]-3-(2,3,4-trifluorophenyl)urea |
| SMILES | CCOc1ccccc1OCNC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H15F3N2O3/c1-2-23-12-5-3-4-6-13(12)24-9-20-16(22)21-11-8-7-10(17)14(18)15(11)19/h3-8H,2,9H2,1H3,(H2,20,21,22) |
| InChIKey | KIIXJIBXHDTKNJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|