C18H20N2O5 — CID 108877191
methyl 2-[(2-ethoxyphenoxy)methylcarbamoylamino]benzoate (PubChem CID 108877191) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is methyl 2-[(2-ethoxyphenoxy)methylcarbamoylamino]benzoate.
| Compound Name | methyl 2-[(2-ethoxyphenoxy)methylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 108877191 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | methyl 2-[(2-ethoxyphenoxy)methylcarbamoylamino]benzoate |
| SMILES | CCOc1ccccc1OCNC(=O)Nc1ccccc1C(=O)OC |
| InChI | InChI=1S/C18H20N2O5/c1-3-24-15-10-6-7-11-16(15)25-12-19-18(22)20-14-9-5-4-8-13(14)17(21)23-2/h4-11H,3,12H2,1-2H3,(H2,19,20,22) |
| InChIKey | QCRLCKRLYAAJBF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|