C18H19ClN2O4 — CID 108877937
methyl 2-[(4-chloro-3,5-dimethylphenoxy)methylcarbamoylamino]benzoate (PubChem CID 108877937) has the molecular formula C18H19ClN2O4 and a molecular weight of 362.81 g/mol. Its IUPAC name is methyl 2-[(4-chloro-3,5-dimethylphenoxy)methylcarbamoylamino]benzoate.
| Compound Name | methyl 2-[(4-chloro-3,5-dimethylphenoxy)methylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 108877937 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | methyl 2-[(4-chloro-3,5-dimethylphenoxy)methylcarbamoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)NCOc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C18H19ClN2O4/c1-11-8-13(9-12(2)16(11)19)25-10-20-18(23)21-15-7-5-4-6-14(15)17(22)24-3/h4-9H,10H2,1-3H3,(H2,20,21,23) |
| InChIKey | WNRSEDNELZKRKH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|