C17H16ClN3O2 — CID 108877870
1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-(2-cyanophenyl)urea (PubChem CID 108877870) has the molecular formula C17H16ClN3O2 and a molecular weight of 329.79 g/mol. Its IUPAC name is 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-(2-cyanophenyl)urea.
| Compound Name | 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-(2-cyanophenyl)urea |
|---|---|
| PubChem CID | 108877870 |
| Molecular Formula | C17H16ClN3O2 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-(2-cyanophenyl)urea |
| SMILES | Cc1cc(OCNC(=O)Nc2ccccc2C#N)cc(C)c1Cl |
| InChI | InChI=1S/C17H16ClN3O2/c1-11-7-14(8-12(2)16(11)18)23-10-20-17(22)21-15-6-4-3-5-13(15)9-19/h3-8H,10H2,1-2H3,(H2,20,21,22) |
| InChIKey | DAUBCAQXYSSUAN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|