C16H15N3O — CID 108991418
1-(2-cyanophenyl)-3-(2,6-dimethylphenyl)urea (PubChem CID 108991418) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 1-(2-cyanophenyl)-3-(2,6-dimethylphenyl)urea.
| Compound Name | 1-(2-cyanophenyl)-3-(2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 108991418 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 1-(2-cyanophenyl)-3-(2,6-dimethylphenyl)urea |
| SMILES | Cc1cccc(C)c1NC(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C16H15N3O/c1-11-6-5-7-12(2)15(11)19-16(20)18-14-9-4-3-8-13(14)10-17/h3-9H,1-2H3,(H2,18,19,20) |
| InChIKey | XOJATFSYPZBORV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |