C23H23ClN2O2 — CID 108877907
1-benzhydryl-3-[(4-chloro-3,5-dimethylphenoxy)methyl]urea (PubChem CID 108877907) has the molecular formula C23H23ClN2O2 and a molecular weight of 394.90 g/mol. Its IUPAC name is 1-benzhydryl-3-[(4-chloro-3,5-dimethylphenoxy)methyl]urea.
| Compound Name | 1-benzhydryl-3-[(4-chloro-3,5-dimethylphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108877907 |
| Molecular Formula | C23H23ClN2O2 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-benzhydryl-3-[(4-chloro-3,5-dimethylphenoxy)methyl]urea |
| SMILES | Cc1cc(OCNC(=O)NC(c2ccccc2)c2ccccc2)cc(C)c1Cl |
| InChI | InChI=1S/C23H23ClN2O2/c1-16-13-20(14-17(2)21(16)24)28-15-25-23(27)26-22(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-14,22H,15H2,1-2H3,(H2,25,26,27) |
| InChIKey | ZKWCCSQULHRQRV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|