C19H23ClN2O3 — CID 108877926
1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-[1-(4-methoxyphenyl)ethyl]urea (PubChem CID 108877926) has the molecular formula C19H23ClN2O3 and a molecular weight of 362.86 g/mol. Its IUPAC name is 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-[1-(4-methoxyphenyl)ethyl]urea.
| Compound Name | 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-[1-(4-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108877926 |
| Molecular Formula | C19H23ClN2O3 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-[1-(4-methoxyphenyl)ethyl]urea |
| SMILES | COc1ccc(C(C)NC(=O)NCOc2cc(C)c(Cl)c(C)c2)cc1 |
| InChI | InChI=1S/C19H23ClN2O3/c1-12-9-17(10-13(2)18(12)20)25-11-21-19(23)22-14(3)15-5-7-16(24-4)8-6-15/h5-10,14H,11H2,1-4H3,(H2,21,22,23) |
| InChIKey | LBAWKVPTXCEIIJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|