C21H28N2O4 — CID 108880163
1-[1-(3,4-dimethoxyphenyl)ethyl]-3-[(2,3,6-trimethylphenoxy)methyl]urea (PubChem CID 108880163) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-[(2,3,6-trimethylphenoxy)methyl]urea.
| Compound Name | 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-[(2,3,6-trimethylphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108880163 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-[(2,3,6-trimethylphenoxy)methyl]urea |
| SMILES | COc1ccc(C(C)NC(=O)NCOc2c(C)ccc(C)c2C)cc1OC |
| InChI | InChI=1S/C21H28N2O4/c1-13-7-8-14(2)20(15(13)3)27-12-22-21(24)23-16(4)17-9-10-18(25-5)19(11-17)26-6/h7-11,16H,12H2,1-6H3,(H2,22,23,24) |
| InChIKey | JUFXHPRCVMNMFD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|