C23H30N2O2 — CID 108880168
1-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-3-[(2,3,6-trimethylphenoxy)methyl]urea (PubChem CID 108880168) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-3-[(2,3,6-trimethylphenoxy)methyl]urea.
| Compound Name | 1-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-3-[(2,3,6-trimethylphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108880168 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 1-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-3-[(2,3,6-trimethylphenoxy)methyl]urea |
| SMILES | Cc1ccc(C)c(OCNC(=O)NC(C)c2ccc3c(c2)CCCC3)c1C |
| InChI | InChI=1S/C23H30N2O2/c1-15-9-10-16(2)22(17(15)3)27-14-24-23(26)25-18(4)20-12-11-19-7-5-6-8-21(19)13-20/h9-13,18H,5-8,14H2,1-4H3,(H2,24,25,26) |
| InChIKey | BNHWEXWUVZNCHU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|