C22H28N2O2 — CID 108893248
1-[(2-ethylphenoxy)methyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]urea (PubChem CID 108893248) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 1-[(2-ethylphenoxy)methyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]urea.
| Compound Name | 1-[(2-ethylphenoxy)methyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 108893248 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 1-[(2-ethylphenoxy)methyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]urea |
| SMILES | CCc1ccccc1OCNC(=O)NC(C)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H28N2O2/c1-3-17-8-6-7-11-21(17)26-15-23-22(25)24-16(2)19-13-12-18-9-4-5-10-20(18)14-19/h6-8,11-14,16H,3-5,9-10,15H2,1-2H3,(H2,23,24,25) |
| InChIKey | PPMRWNAEPSSPLW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|