C23H30N2O2 — CID 108881273
1-[3-(4-methylphenoxy)propyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]urea (PubChem CID 108881273) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-[3-(4-methylphenoxy)propyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]urea.
| Compound Name | 1-[3-(4-methylphenoxy)propyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 108881273 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 1-[3-(4-methylphenoxy)propyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]urea |
| SMILES | Cc1ccc(OCCCNC(=O)NC(C)c2ccc3c(c2)CCCC3)cc1 |
| InChI | InChI=1S/C23H30N2O2/c1-17-8-12-22(13-9-17)27-15-5-14-24-23(26)25-18(2)20-11-10-19-6-3-4-7-21(19)16-20/h8-13,16,18H,3-7,14-15H2,1-2H3,(H2,24,25,26) |
| InChIKey | AMIGNSMDKNMMPB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|