C18H21ClN2O4 — CID 108877934
1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-(2,5-dimethoxyphenyl)urea (PubChem CID 108877934) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-(2,5-dimethoxyphenyl)urea.
| Compound Name | 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-(2,5-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 108877934 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-(2,5-dimethoxyphenyl)urea |
| SMILES | COc1ccc(OC)c(NC(=O)NCOc2cc(C)c(Cl)c(C)c2)c1 |
| InChI | InChI=1S/C18H21ClN2O4/c1-11-7-14(8-12(2)17(11)19)25-10-20-18(22)21-15-9-13(23-3)5-6-16(15)24-4/h5-9H,10H2,1-4H3,(H2,20,21,22) |
| InChIKey | VRWFOGXFLVOSBZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|