C16H15Cl2FN2O2 — CID 108878088
1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-(3-chloro-4-fluorophenyl)urea (PubChem CID 108878088) has the molecular formula C16H15Cl2FN2O2 and a molecular weight of 357.21 g/mol. Its IUPAC name is 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-(3-chloro-4-fluorophenyl)urea.
| Compound Name | 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-(3-chloro-4-fluorophenyl)urea |
|---|---|
| PubChem CID | 108878088 |
| Molecular Formula | C16H15Cl2FN2O2 |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-(3-chloro-4-fluorophenyl)urea |
| SMILES | Cc1cc(OCNC(=O)Nc2ccc(F)c(Cl)c2)cc(C)c1Cl |
| InChI | InChI=1S/C16H15Cl2FN2O2/c1-9-5-12(6-10(2)15(9)18)23-8-20-16(22)21-11-3-4-14(19)13(17)7-11/h3-7H,8H2,1-2H3,(H2,20,21,22) |
| InChIKey | MEKQJNJPDYLITH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|