C20H25ClN2O2 — CID 108877931
1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-(2,6-diethylphenyl)urea (PubChem CID 108877931) has the molecular formula C20H25ClN2O2 and a molecular weight of 360.89 g/mol. Its IUPAC name is 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-(2,6-diethylphenyl)urea.
| Compound Name | 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-(2,6-diethylphenyl)urea |
|---|---|
| PubChem CID | 108877931 |
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-3-(2,6-diethylphenyl)urea |
| SMILES | CCc1cccc(CC)c1NC(=O)NCOc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C20H25ClN2O2/c1-5-15-8-7-9-16(6-2)19(15)23-20(24)22-12-25-17-10-13(3)18(21)14(4)11-17/h7-11H,5-6,12H2,1-4H3,(H2,22,23,24) |
| InChIKey | JTWXEUTZCCMVBB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|