C17H20ClN3O2 — CID 108878155
1-(2-amino-4-methylphenyl)-3-[(4-chloro-3,5-dimethylphenoxy)methyl]urea (PubChem CID 108878155) has the molecular formula C17H20ClN3O2 and a molecular weight of 333.82 g/mol. Its IUPAC name is 1-(2-amino-4-methylphenyl)-3-[(4-chloro-3,5-dimethylphenoxy)methyl]urea.
| Compound Name | 1-(2-amino-4-methylphenyl)-3-[(4-chloro-3,5-dimethylphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108878155 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 1-(2-amino-4-methylphenyl)-3-[(4-chloro-3,5-dimethylphenoxy)methyl]urea |
| SMILES | Cc1ccc(NC(=O)NCOc2cc(C)c(Cl)c(C)c2)c(N)c1 |
| InChI | InChI=1S/C17H20ClN3O2/c1-10-4-5-15(14(19)6-10)21-17(22)20-9-23-13-7-11(2)16(18)12(3)8-13/h4-8H,9,19H2,1-3H3,(H2,20,21,22) |
| InChIKey | SNJIDXMLEIWMSU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|